C11H14FNO3 — CID 174413387
N-[4-fluoro-2-(3-hydroxypropoxy)phenyl]acetamide (PubChem CID 174413387) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is N-[4-fluoro-2-(3-hydroxypropoxy)phenyl]acetamide.
| Compound Name | N-[4-fluoro-2-(3-hydroxypropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 174413387 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N-[4-fluoro-2-(3-hydroxypropoxy)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)cc1OCCCO |
| InChI | InChI=1S/C11H14FNO3/c1-8(15)13-10-4-3-9(12)7-11(10)16-6-2-5-14/h3-4,7,14H,2,5-6H2,1H3,(H,13,15) |
| InChIKey | OGLSTQNSIHIXQW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|