C10H12ClNO4 — CID 68918743
[4-chloro-2-(3-hydroxypropoxy)phenyl]carbamic acid (PubChem CID 68918743) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is [4-chloro-2-(3-hydroxypropoxy)phenyl]carbamic acid.
| Compound Name | [4-chloro-2-(3-hydroxypropoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 68918743 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | [4-chloro-2-(3-hydroxypropoxy)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(Cl)cc1OCCCO |
| InChI | InChI=1S/C10H12ClNO4/c11-7-2-3-8(12-10(14)15)9(6-7)16-5-1-4-13/h2-3,6,12-13H,1,4-5H2,(H,14,15) |
| InChIKey | VTJKTGCEIDCBBR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|