C22H28ClNO3 — CID 89260275
4-chloro-N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2-(3-phenylmethoxypropoxy)aniline (PubChem CID 89260275) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is 4-chloro-N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2-(3-phenylmethoxypropoxy)aniline.
| Compound Name | 4-chloro-N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2-(3-phenylmethoxypropoxy)aniline |
|---|---|
| PubChem CID | 89260275 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-chloro-N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]-2-(3-phenylmethoxypropoxy)aniline |
| SMILES | C=C(Nc1ccc(Cl)cc1OCCCOCc1ccccc1)OC(C)(C)C |
| InChI | InChI=1S/C22H28ClNO3/c1-17(27-22(2,3)4)24-20-12-11-19(23)15-21(20)26-14-8-13-25-16-18-9-6-5-7-10-18/h5-7,9-12,15,24H,1,8,13-14,16H2,2-4H3 |
| InChIKey | ZWPPUKGNFUGNQT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|