C14H23N3O3 — CID 47434526
1-butyl-3-(1-ethyl-6-oxo-3-pyridinyl)-1-(2-hydroxyethyl)urea (PubChem CID 47434526) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-butyl-3-(1-ethyl-6-oxo-3-pyridinyl)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-butyl-3-(1-ethyl-6-oxo-3-pyridinyl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 47434526 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-butyl-3-(1-ethyl-6-oxo-3-pyridinyl)-1-(2-hydroxyethyl)urea |
| SMILES | CCCCN(CCO)C(=O)Nc1ccc(=O)n(CC)c1 |
| InChI | InChI=1S/C14H23N3O3/c1-3-5-8-17(9-10-18)14(20)15-12-6-7-13(19)16(4-2)11-12/h6-7,11,18H,3-5,8-10H2,1-2H3,(H,15,20) |
| InChIKey | OZCGXVIUUSMTDZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |