C9H11BrN2O2 — CID 63680648
2-bromo-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide (PubChem CID 63680648) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-bromo-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide.
| Compound Name | 2-bromo-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 63680648 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 2-bromo-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide |
| SMILES | CCn1cc(NC(=O)CBr)ccc1=O |
| InChI | InChI=1S/C9H11BrN2O2/c1-2-12-6-7(3-4-9(12)14)11-8(13)5-10/h3-4,6H,2,5H2,1H3,(H,11,13) |
| InChIKey | AYTVZMUMQAGVHP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|