C15H17N3O2 — CID 60927957
2-anilino-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide (PubChem CID 60927957) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-anilino-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide.
| Compound Name | 2-anilino-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 60927957 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-anilino-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide |
| SMILES | CCn1cc(NC(=O)CNc2ccccc2)ccc1=O |
| InChI | InChI=1S/C15H17N3O2/c1-2-18-11-13(8-9-15(18)20)17-14(19)10-16-12-6-4-3-5-7-12/h3-9,11,16H,2,10H2,1H3,(H,17,19) |
| InChIKey | BMJRDWUEVMVSFO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |