C15H14Cl2N2O2 — CID 47048969
2-(2,6-dichlorophenyl)-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide (PubChem CID 47048969) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 47048969 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(1-ethyl-6-oxo-3-pyridinyl)acetamide |
| SMILES | CCn1cc(NC(=O)Cc2c(Cl)cccc2Cl)ccc1=O |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-2-19-9-10(6-7-15(19)21)18-14(20)8-11-12(16)4-3-5-13(11)17/h3-7,9H,2,8H2,1H3,(H,18,20) |
| InChIKey | IBFNUQMVFAGRII-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |