C12H12ClF2NO4 — CID 82782990
2-[(4-chloro-2,5-difluorobenzoyl)-(2-methoxyethyl)amino]acetic acid (PubChem CID 82782990) has the molecular formula C12H12ClF2NO4 and a molecular weight of 307.68 g/mol. Its IUPAC name is 2-[(4-chloro-2,5-difluorobenzoyl)-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[(4-chloro-2,5-difluorobenzoyl)-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 82782990 |
| Molecular Formula | C12H12ClF2NO4 |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-[(4-chloro-2,5-difluorobenzoyl)-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H12ClF2NO4/c1-20-3-2-16(6-11(17)18)12(19)7-4-10(15)8(13)5-9(7)14/h4-5H,2-3,6H2,1H3,(H,17,18) |
| InChIKey | KMVSHGHGLJXNDE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|