C13H13ClF2N2O2 — CID 82772600
4-chloro-N-(2-cyanoethyl)-2,5-difluoro-N-(2-methoxyethyl)benzamide (PubChem CID 82772600) has the molecular formula C13H13ClF2N2O2 and a molecular weight of 302.71 g/mol. Its IUPAC name is 4-chloro-N-(2-cyanoethyl)-2,5-difluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-chloro-N-(2-cyanoethyl)-2,5-difluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 82772600 |
| Molecular Formula | C13H13ClF2N2O2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-chloro-N-(2-cyanoethyl)-2,5-difluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCC#N)C(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H13ClF2N2O2/c1-20-6-5-18(4-2-3-17)13(19)9-7-12(16)10(14)8-11(9)15/h7-8H,2,4-6H2,1H3 |
| InChIKey | OBKIAGGXQVATJP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|