C13H15ClN2O2S — CID 107029635
2-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-5-sulfanylbenzamide (PubChem CID 107029635) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107029635 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-5-sulfanylbenzamide |
| SMILES | COCCN(CCC#N)C(=O)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O2S/c1-18-8-7-16(6-2-5-15)13(17)11-9-10(19)3-4-12(11)14/h3-4,9,19H,2,6-8H2,1H3 |
| InChIKey | BLZFLWGGHCOCQV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|