C12H15FN4O2 — CID 105386249
2-amino-N-(2-cyanoethyl)-3-fluoro-N-(2-methoxyethyl)pyridine-4-carboxamide (PubChem CID 105386249) has the molecular formula C12H15FN4O2 and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-amino-N-(2-cyanoethyl)-3-fluoro-N-(2-methoxyethyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-N-(2-cyanoethyl)-3-fluoro-N-(2-methoxyethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105386249 |
| Molecular Formula | C12H15FN4O2 |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-amino-N-(2-cyanoethyl)-3-fluoro-N-(2-methoxyethyl)pyridine-4-carboxamide |
| SMILES | COCCN(CCC#N)C(=O)c1ccnc(N)c1F |
| InChI | InChI=1S/C12H15FN4O2/c1-19-8-7-17(6-2-4-14)12(18)9-3-5-16-11(15)10(9)13/h3,5H,2,6-8H2,1H3,(H2,15,16) |
| InChIKey | KIGIMTXJFSFTSQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |