C14H17Cl2N5O2 — CID 7368682
(2R)-N-(2-butyltetrazol-5-yl)-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 7368682) has the molecular formula C14H17Cl2N5O2 and a molecular weight of 358.23 g/mol. Its IUPAC name is (2R)-N-(2-butyltetrazol-5-yl)-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | (2R)-N-(2-butyltetrazol-5-yl)-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 7368682 |
| Molecular Formula | C14H17Cl2N5O2 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (2R)-N-(2-butyltetrazol-5-yl)-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CCCCn1nnc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H17Cl2N5O2/c1-3-4-7-21-19-14(18-20-21)17-13(22)9(2)23-12-6-5-10(15)8-11(12)16/h5-6,8-9H,3-4,7H2,1-2H3,(H,17,19,22)/t9-/m1/s1 |
| InChIKey | GVNHSLXGHDKBJA-SECBINFHSA-N |
| XLogP | 3.19 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |