C23H18Br2N2OS — CID 17318493
N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-4-propan-2-ylbenzamide (PubChem CID 17318493) has the molecular formula C23H18Br2N2OS and a molecular weight of 530.29 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 17318493 |
| Molecular Formula | C23H18Br2N2OS |
| Molecular Weight | 530.29 g/mol |
| Exact Mass | 527.95 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)Nc2c(Br)cc(Br)cc2-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H18Br2N2OS/c1-13(2)14-7-9-15(10-8-14)22(28)27-21-17(11-16(24)12-18(21)25)23-26-19-5-3-4-6-20(19)29-23/h3-13H,1-2H3,(H,27,28) |
| InChIKey | JVWOGUKNJRRQME-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.29 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |