C19H16ClF3N4O4S — CID 5089453
4-chloro-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-nitrobenzamide (PubChem CID 5089453) has the molecular formula C19H16ClF3N4O4S and a molecular weight of 488.88 g/mol. Its IUPAC name is 4-chloro-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 5089453 |
| Molecular Formula | C19H16ClF3N4O4S |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 4-chloro-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1cc(C(F)(F)F)ccc1N1CCOCC1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16ClF3N4O4S/c20-13-3-1-11(9-16(13)27(29)30)17(28)25-18(32)24-14-10-12(19(21,22)23)2-4-15(14)26-5-7-31-8-6-26/h1-4,9-10H,5-8H2,(H2,24,25,28,32) |
| InChIKey | GJJNJCRMGNHFKI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|