C20H19ClF3N3O2S — CID 5088986
2-chloro-4-methyl-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 5088986) has the molecular formula C20H19ClF3N3O2S and a molecular weight of 457.91 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5088986 |
| Molecular Formula | C20H19ClF3N3O2S |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-chloro-4-methyl-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc(C(F)(F)F)ccc2N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClF3N3O2S/c1-12-2-4-14(15(21)10-12)18(28)26-19(30)25-16-11-13(20(22,23)24)3-5-17(16)27-6-8-29-9-7-27/h2-5,10-11H,6-9H2,1H3,(H2,25,26,28,30) |
| InChIKey | VHIVIHKHKXGUSP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|