C19H16F3N5O6S — CID 5089451
N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3,5-dinitrobenzamide (PubChem CID 5089451) has the molecular formula C19H16F3N5O6S and a molecular weight of 499.43 g/mol. Its IUPAC name is N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 5089451 |
| Molecular Formula | C19H16F3N5O6S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NC(=S)Nc1cc(C(F)(F)F)ccc1N1CCOCC1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16F3N5O6S/c20-19(21,22)12-1-2-16(25-3-5-33-6-4-25)15(9-12)23-18(34)24-17(28)11-7-13(26(29)30)10-14(8-11)27(31)32/h1-2,7-10H,3-6H2,(H2,23,24,28,34) |
| InChIKey | ZSEFVRADHIIYNH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|