C20H19F3N4O4S — CID 5089449
4-methyl-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-nitrobenzamide (PubChem CID 5089449) has the molecular formula C20H19F3N4O4S and a molecular weight of 468.46 g/mol. Its IUPAC name is 4-methyl-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | 4-methyl-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 5089449 |
| Molecular Formula | C20H19F3N4O4S |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 4-methyl-N-[[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc(C(F)(F)F)ccc2N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19F3N4O4S/c1-12-2-3-13(10-17(12)27(29)30)18(28)25-19(32)24-15-11-14(20(21,22)23)4-5-16(15)26-6-8-31-9-7-26/h2-5,10-11H,6-9H2,1H3,(H2,24,25,28,32) |
| InChIKey | ODIWESGVCSPACX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|