C22H25ClN4O3S — CID 17313569
methyl 3-[(2-chloro-4-methylbenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 17313569) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is methyl 3-[(2-chloro-4-methylbenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | methyl 3-[(2-chloro-4-methylbenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 17313569 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | methyl 3-[(2-chloro-4-methylbenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C)CC2)c(NC(=S)NC(=O)c2ccc(C)cc2Cl)c1 |
| InChI | InChI=1S/C22H25ClN4O3S/c1-14-4-6-16(17(23)12-14)20(28)25-22(31)24-18-13-15(21(29)30-3)5-7-19(18)27-10-8-26(2)9-11-27/h4-7,12-13H,8-11H2,1-3H3,(H2,24,25,28,31) |
| InChIKey | KIRWUWNWYPAXMO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|