C17H27N4OS+ — CID 2302022
N-[[2-(4-methylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]pentanamide (PubChem CID 2302022) has the molecular formula C17H27N4OS+ and a molecular weight of 335.50 g/mol. Its IUPAC name is N-[[2-(4-methylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]pentanamide.
| Compound Name | N-[[2-(4-methylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 2302022 |
| Molecular Formula | C17H27N4OS+ |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-[[2-(4-methylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)Nc1ccccc1N1CC[NH+](C)CC1 |
| InChI | InChI=1S/C17H26N4OS/c1-3-4-9-16(22)19-17(23)18-14-7-5-6-8-15(14)21-12-10-20(2)11-13-21/h5-8H,3-4,9-13H2,1-2H3,(H2,18,19,22,23)/p+1 |
| InChIKey | CQDSUOHYHZUSNJ-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|