C17H26N2OS — CID 54789169
N-[(2-propan-2-ylphenyl)carbamothioyl]heptanamide (PubChem CID 54789169) has the molecular formula C17H26N2OS and a molecular weight of 306.48 g/mol. Its IUPAC name is N-[(2-propan-2-ylphenyl)carbamothioyl]heptanamide.
| Compound Name | N-[(2-propan-2-ylphenyl)carbamothioyl]heptanamide |
|---|---|
| PubChem CID | 54789169 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-[(2-propan-2-ylphenyl)carbamothioyl]heptanamide |
| SMILES | CCCCCCC(=O)NC(=S)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C17H26N2OS/c1-4-5-6-7-12-16(20)19-17(21)18-15-11-9-8-10-14(15)13(2)3/h8-11,13H,4-7,12H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | JAHUHBUHNRZKOQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|