C18H28N3O3S+ — CID 8714615
4-butoxy-N-[4-(2-hydroxyethyl)piperazin-4-ium-1-carbothioyl]benzamide (PubChem CID 8714615) has the molecular formula C18H28N3O3S+ and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-butoxy-N-[4-(2-hydroxyethyl)piperazin-4-ium-1-carbothioyl]benzamide.
| Compound Name | 4-butoxy-N-[4-(2-hydroxyethyl)piperazin-4-ium-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 8714615 |
| Molecular Formula | C18H28N3O3S+ |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-butoxy-N-[4-(2-hydroxyethyl)piperazin-4-ium-1-carbothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)N2CC[NH+](CCO)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O3S/c1-2-3-14-24-16-6-4-15(5-7-16)17(23)19-18(25)21-10-8-20(9-11-21)12-13-22/h4-7,22H,2-3,8-14H2,1H3,(H,19,23,25)/p+1 |
| InChIKey | UQWIOANOEHCTGS-UHFFFAOYSA-O |
| XLogP | 0.07 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|