C25H35N3O6 — CID 55470812
1-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazin-1-yl]-4-(4-pentoxyphenyl)butane-1,4-dione (PubChem CID 55470812) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is 1-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazin-1-yl]-4-(4-pentoxyphenyl)butane-1,4-dione.
| Compound Name | 1-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazin-1-yl]-4-(4-pentoxyphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 55470812 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 1-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazin-1-yl]-4-(4-pentoxyphenyl)butane-1,4-dione |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)N2CCN(C(=O)C(=O)N3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C25H35N3O6/c1-2-3-4-17-34-21-7-5-20(6-8-21)22(29)9-10-23(30)26-11-13-27(14-12-26)24(31)25(32)28-15-18-33-19-16-28/h5-8H,2-4,9-19H2,1H3 |
| InChIKey | AXHTVJYPXQZZPC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|