C20H30N2O3 — CID 112759546
1-(4-methylpiperazin-1-yl)-4-(4-pentoxyphenyl)butane-1,4-dione (PubChem CID 112759546) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-4-(4-pentoxyphenyl)butane-1,4-dione.
| Compound Name | 1-(4-methylpiperazin-1-yl)-4-(4-pentoxyphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 112759546 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-4-(4-pentoxyphenyl)butane-1,4-dione |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-3-4-5-16-25-18-8-6-17(7-9-18)19(23)10-11-20(24)22-14-12-21(2)13-15-22/h6-9H,3-5,10-16H2,1-2H3 |
| InChIKey | SNWIWZCSUOSNBX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|