C25H19BrN2O4 — CID 6352024
4-[[(2E,4E)-2-[(3-bromobenzoyl)amino]-5-phenylpenta-2,4-dienoyl]amino]benzoic acid (PubChem CID 6352024) has the molecular formula C25H19BrN2O4 and a molecular weight of 491.34 g/mol. Its IUPAC name is 4-[[(2E,4E)-2-[(3-bromobenzoyl)amino]-5-phenylpenta-2,4-dienoyl]amino]benzoic acid.
| Compound Name | 4-[[(2E,4E)-2-[(3-bromobenzoyl)amino]-5-phenylpenta-2,4-dienoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 6352024 |
| Molecular Formula | C25H19BrN2O4 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 4-[[(2E,4E)-2-[(3-bromobenzoyl)amino]-5-phenylpenta-2,4-dienoyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)cc1)/C(=C\C=C\c1ccccc1)NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C25H19BrN2O4/c26-20-10-5-9-19(16-20)23(29)28-22(11-4-8-17-6-2-1-3-7-17)24(30)27-21-14-12-18(13-15-21)25(31)32/h1-16H,(H,27,30)(H,28,29)(H,31,32)/b8-4+,22-11+ |
| InChIKey | YMVCQWCOYDEEDS-KSWJTFLNSA-N |
| XLogP | 5.11 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|