C21H21BrN2O5 — CID 175509776
4-[[3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoyl]amino]benzoic acid (PubChem CID 175509776) has the molecular formula C21H21BrN2O5 and a molecular weight of 461.31 g/mol. Its IUPAC name is 4-[[3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175509776 |
| Molecular Formula | C21H21BrN2O5 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 4-[[3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoyl]amino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NC(=Cc1cccc(Br)c1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H21BrN2O5/c1-21(2,3)29-20(28)24-17(12-13-5-4-6-15(22)11-13)18(25)23-16-9-7-14(8-10-16)19(26)27/h4-12H,1-3H3,(H,23,25)(H,24,28)(H,26,27) |
| InChIKey | DDFJAPFYDWEZKW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|