C31H30N2O2 — CID 108767321
(E)-N-[2-(4-methylanilino)phenyl]-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 108767321) has the molecular formula C31H30N2O2 and a molecular weight of 462.59 g/mol. Its IUPAC name is (E)-N-[2-(4-methylanilino)phenyl]-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-methylanilino)phenyl]-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108767321 |
| Molecular Formula | C31H30N2O2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (E)-N-[2-(4-methylanilino)phenyl]-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | Cc1ccc(Nc2ccccc2NC(=O)/C(=C/c2ccc(OC(C)C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30N2O2/c1-22(2)35-27-19-15-24(16-20-27)21-28(25-9-5-4-6-10-25)31(34)33-30-12-8-7-11-29(30)32-26-17-13-23(3)14-18-26/h4-22,32H,1-3H3,(H,33,34)/b28-21+ |
| InChIKey | YEPRFKXZFOJZOI-SGWCAAJKSA-N |
| XLogP | 7.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|