C25H23NO5 — CID 108766501
3-hydroxy-4-[[(E)-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 108766501) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is 3-hydroxy-4-[[(E)-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-hydroxy-4-[[(E)-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108766501 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-hydroxy-4-[[(E)-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | CC(C)Oc1ccc(/C=C(/C(=O)Nc2ccc(C(=O)O)cc2O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23NO5/c1-16(2)31-20-11-8-17(9-12-20)14-21(18-6-4-3-5-7-18)24(28)26-22-13-10-19(25(29)30)15-23(22)27/h3-16,27H,1-2H3,(H,26,28)(H,29,30)/b21-14+ |
| InChIKey | MJTIYIZXEHFZSZ-KGENOOAVSA-N |
| XLogP | 5.06 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|