C28H23N3O2 — CID 17200377
2-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 17200377) has the molecular formula C28H23N3O2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17200377 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCc1cccnc1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23N3O2/c32-27(30-20-22-12-9-17-29-19-22)24-15-7-8-16-26(24)31-28(33)25(23-13-5-2-6-14-23)18-21-10-3-1-4-11-21/h1-19H,20H2,(H,30,32)(H,31,33)/b25-18- |
| InChIKey | NJURGIOJEMESME-BWAHOGKJSA-N |
| XLogP | 5.19 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|