C16H18F2N2O — CID 97096345
(1S)-1-[4-(difluoromethoxy)phenyl]-N-(pyridin-3-ylmethyl)propan-1-amine (PubChem CID 97096345) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is (1S)-1-[4-(difluoromethoxy)phenyl]-N-(pyridin-3-ylmethyl)propan-1-amine.
| Compound Name | (1S)-1-[4-(difluoromethoxy)phenyl]-N-(pyridin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 97096345 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (1S)-1-[4-(difluoromethoxy)phenyl]-N-(pyridin-3-ylmethyl)propan-1-amine |
| SMILES | CC[C@H](NCc1cccnc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H18F2N2O/c1-2-15(20-11-12-4-3-9-19-10-12)13-5-7-14(8-6-13)21-16(17)18/h3-10,15-16,20H,2,11H2,1H3/t15-/m0/s1 |
| InChIKey | LEKLIHAZYSBIDE-HNNXBMFYSA-N |
| XLogP | 3.92 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |