C16H19ClN2 — CID 43204940
1-(4-chlorophenyl)-N-(pyridin-3-ylmethyl)butan-1-amine (PubChem CID 43204940) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(pyridin-3-ylmethyl)butan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-N-(pyridin-3-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 43204940 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(pyridin-3-ylmethyl)butan-1-amine |
| SMILES | CCCC(NCc1cccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN2/c1-2-4-16(14-6-8-15(17)9-7-14)19-12-13-5-3-10-18-11-13/h3,5-11,16,19H,2,4,12H2,1H3 |
| InChIKey | ZBKVAIVWDSRVPR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |