C17H19F2N3O4S — CID 55738445
1-[3-(difluoromethoxy)phenyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]urea (PubChem CID 55738445) has the molecular formula C17H19F2N3O4S and a molecular weight of 399.42 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55738445 |
| Molecular Formula | C17H19F2N3O4S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[[4-(dimethylsulfamoyl)phenyl]methyl]urea |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNC(=O)Nc2cccc(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C17H19F2N3O4S/c1-22(2)27(24,25)15-8-6-12(7-9-15)11-20-17(23)21-13-4-3-5-14(10-13)26-16(18)19/h3-10,16H,11H2,1-2H3,(H2,20,21,23) |
| InChIKey | KQSVAYIPMRZFPL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |