C19H25N3O3S — CID 47038741
1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 47038741) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 47038741 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NCc2ccc(S(=O)(=O)N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-13-10-14(2)18(15(3)11-13)21-19(23)20-12-16-6-8-17(9-7-16)26(24,25)22(4)5/h6-11H,12H2,1-5H3,(H2,20,21,23) |
| InChIKey | YYPBKJZJIFAECW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |