C15H23N3O4S — CID 17248911
N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N',N'-diethyloxamide (PubChem CID 17248911) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N',N'-diethyloxamide.
| Compound Name | N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N',N'-diethyloxamide |
|---|---|
| PubChem CID | 17248911 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N',N'-diethyloxamide |
| SMILES | CCN(CC)C(=O)C(=O)NCc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C15H23N3O4S/c1-5-18(6-2)15(20)14(19)16-11-12-7-9-13(10-8-12)23(21,22)17(3)4/h7-10H,5-6,11H2,1-4H3,(H,16,19) |
| InChIKey | GQWGWUBNFLTKHX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|