C20H33N3O4S — CID 56546081
N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N',N'-dipropylpentanediamide (PubChem CID 56546081) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N',N'-dipropylpentanediamide.
| Compound Name | N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56546081 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NCc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C20H33N3O4S/c1-5-14-23(15-6-2)20(25)9-7-8-19(24)21-16-17-10-12-18(13-11-17)28(26,27)22(3)4/h10-13H,5-9,14-16H2,1-4H3,(H,21,24) |
| InChIKey | DOTNKXAEOPSPRN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |