C23H39N3O2 — CID 56545187
N-[[3-(diethylaminomethyl)phenyl]methyl]-N',N'-dipropylpentanediamide (PubChem CID 56545187) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is N-[[3-(diethylaminomethyl)phenyl]methyl]-N',N'-dipropylpentanediamide.
| Compound Name | N-[[3-(diethylaminomethyl)phenyl]methyl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56545187 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | N-[[3-(diethylaminomethyl)phenyl]methyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NCc1cccc(CN(CC)CC)c1 |
| InChI | InChI=1S/C23H39N3O2/c1-5-15-26(16-6-2)23(28)14-10-13-22(27)24-18-20-11-9-12-21(17-20)19-25(7-3)8-4/h9,11-12,17H,5-8,10,13-16,18-19H2,1-4H3,(H,24,27) |
| InChIKey | FHZULSKNTIGIQP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |