C15H26ClN3O — CID 120703880
N-[[3-(diethylaminomethyl)phenyl]methyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 120703880) has the molecular formula C15H26ClN3O and a molecular weight of 299.85 g/mol. Its IUPAC name is N-[[3-(diethylaminomethyl)phenyl]methyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[[3-(diethylaminomethyl)phenyl]methyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120703880 |
| Molecular Formula | C15H26ClN3O |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-[[3-(diethylaminomethyl)phenyl]methyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CCN(CC)Cc1cccc(CNC(=O)CNC)c1.Cl |
| InChI | InChI=1S/C15H25N3O.ClH/c1-4-18(5-2)12-14-8-6-7-13(9-14)10-17-15(19)11-16-3;/h6-9,16H,4-5,10-12H2,1-3H3,(H,17,19);1H |
| InChIKey | AYEJWXYAVURJAS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |