C25H41N3O2 — CID 56545515
N-[[3-(azepan-1-ylmethyl)phenyl]methyl]-N',N'-dipropylpentanediamide (PubChem CID 56545515) has the molecular formula C25H41N3O2 and a molecular weight of 415.62 g/mol. Its IUPAC name is N-[[3-(azepan-1-ylmethyl)phenyl]methyl]-N',N'-dipropylpentanediamide.
| Compound Name | N-[[3-(azepan-1-ylmethyl)phenyl]methyl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56545515 |
| Molecular Formula | C25H41N3O2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | N-[[3-(azepan-1-ylmethyl)phenyl]methyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NCc1cccc(CN2CCCCCC2)c1 |
| InChI | InChI=1S/C25H41N3O2/c1-3-15-28(16-4-2)25(30)14-10-13-24(29)26-20-22-11-9-12-23(19-22)21-27-17-7-5-6-8-18-27/h9,11-12,19H,3-8,10,13-18,20-21H2,1-2H3,(H,26,29) |
| InChIKey | HYLQXPIHWNCBGX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |