C20H32N2OS — CID 60604979
N-[[3-(azepan-1-ylmethyl)phenyl]methyl]-2-tert-butylsulfanylacetamide (PubChem CID 60604979) has the molecular formula C20H32N2OS and a molecular weight of 348.56 g/mol. Its IUPAC name is N-[[3-(azepan-1-ylmethyl)phenyl]methyl]-2-tert-butylsulfanylacetamide.
| Compound Name | N-[[3-(azepan-1-ylmethyl)phenyl]methyl]-2-tert-butylsulfanylacetamide |
|---|---|
| PubChem CID | 60604979 |
| Molecular Formula | C20H32N2OS |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[[3-(azepan-1-ylmethyl)phenyl]methyl]-2-tert-butylsulfanylacetamide |
| SMILES | CC(C)(C)SCC(=O)NCc1cccc(CN2CCCCCC2)c1 |
| InChI | InChI=1S/C20H32N2OS/c1-20(2,3)24-16-19(23)21-14-17-9-8-10-18(13-17)15-22-11-6-4-5-7-12-22/h8-10,13H,4-7,11-12,14-16H2,1-3H3,(H,21,23) |
| InChIKey | RPBFZBKRDNVVRT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |