C13H19NO2S — CID 54904297
2-tert-butylsulfanyl-N-[(3-hydroxyphenyl)methyl]acetamide (PubChem CID 54904297) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-[(3-hydroxyphenyl)methyl]acetamide.
| Compound Name | 2-tert-butylsulfanyl-N-[(3-hydroxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54904297 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-tert-butylsulfanyl-N-[(3-hydroxyphenyl)methyl]acetamide |
| SMILES | CC(C)(C)SCC(=O)NCc1cccc(O)c1 |
| InChI | InChI=1S/C13H19NO2S/c1-13(2,3)17-9-12(16)14-8-10-5-4-6-11(15)7-10/h4-7,15H,8-9H2,1-3H3,(H,14,16) |
| InChIKey | JHQDGYHAENJQHJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |