C16H17Cl2N3O3S — CID 47038787
1-(3,5-dichlorophenyl)-3-[[4-(dimethylsulfamoyl)phenyl]methyl]urea (PubChem CID 47038787) has the molecular formula C16H17Cl2N3O3S and a molecular weight of 402.30 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[[4-(dimethylsulfamoyl)phenyl]methyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[[4-(dimethylsulfamoyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 47038787 |
| Molecular Formula | C16H17Cl2N3O3S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[[4-(dimethylsulfamoyl)phenyl]methyl]urea |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNC(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H17Cl2N3O3S/c1-21(2)25(23,24)15-5-3-11(4-6-15)10-19-16(22)20-14-8-12(17)7-13(18)9-14/h3-9H,10H2,1-2H3,(H2,19,20,22) |
| InChIKey | CNRFUJOQWSGRJR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |