C18H21F2N3O4S — CID 55696852
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[3-(dimethylsulfamoyl)phenyl]-1-methylurea (PubChem CID 55696852) has the molecular formula C18H21F2N3O4S and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[3-(dimethylsulfamoyl)phenyl]-1-methylurea.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[3-(dimethylsulfamoyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 55696852 |
| Molecular Formula | C18H21F2N3O4S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[3-(dimethylsulfamoyl)phenyl]-1-methylurea |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H21F2N3O4S/c1-22(2)28(25,26)16-6-4-5-14(11-16)21-18(24)23(3)12-13-7-9-15(10-8-13)27-17(19)20/h4-11,17H,12H2,1-3H3,(H,21,24) |
| InChIKey | VOFYVGKPNUWICP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |