C16H16F3N3O4S — CID 38218632
1-methyl-3-(3-sulfamoylphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 38218632) has the molecular formula C16H16F3N3O4S and a molecular weight of 403.38 g/mol. Its IUPAC name is 1-methyl-3-(3-sulfamoylphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-methyl-3-(3-sulfamoylphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 38218632 |
| Molecular Formula | C16H16F3N3O4S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-methyl-3-(3-sulfamoylphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H16F3N3O4S/c1-22(10-11-5-7-13(8-6-11)26-16(17,18)19)15(23)21-12-3-2-4-14(9-12)27(20,24)25/h2-9H,10H2,1H3,(H,21,23)(H2,20,24,25) |
| InChIKey | LBTCQTXHGDIFTO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |