C23H19F2N3O3 — CID 60591675
3-[4-(4-cyanophenoxy)phenyl]-1-[[4-(difluoromethoxy)phenyl]methyl]-1-methylurea (PubChem CID 60591675) has the molecular formula C23H19F2N3O3 and a molecular weight of 423.42 g/mol. Its IUPAC name is 3-[4-(4-cyanophenoxy)phenyl]-1-[[4-(difluoromethoxy)phenyl]methyl]-1-methylurea.
| Compound Name | 3-[4-(4-cyanophenoxy)phenyl]-1-[[4-(difluoromethoxy)phenyl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 60591675 |
| Molecular Formula | C23H19F2N3O3 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-[4-(4-cyanophenoxy)phenyl]-1-[[4-(difluoromethoxy)phenyl]methyl]-1-methylurea |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)Nc1ccc(Oc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C23H19F2N3O3/c1-28(15-17-4-10-21(11-5-17)31-22(24)25)23(29)27-18-6-12-20(13-7-18)30-19-8-2-16(14-26)3-9-19/h2-13,22H,15H2,1H3,(H,27,29) |
| InChIKey | CPCZUDAKEJUDEW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |