C17H19F2N3O2S — CID 60603061
1-[[4-(difluoromethoxy)phenyl]methyl]-3-(6-ethylsulfanyl-3-pyridinyl)-1-methylurea (PubChem CID 60603061) has the molecular formula C17H19F2N3O2S and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(6-ethylsulfanyl-3-pyridinyl)-1-methylurea.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(6-ethylsulfanyl-3-pyridinyl)-1-methylurea |
|---|---|
| PubChem CID | 60603061 |
| Molecular Formula | C17H19F2N3O2S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(6-ethylsulfanyl-3-pyridinyl)-1-methylurea |
| SMILES | CCSc1ccc(NC(=O)N(C)Cc2ccc(OC(F)F)cc2)cn1 |
| InChI | InChI=1S/C17H19F2N3O2S/c1-3-25-15-9-6-13(10-20-15)21-17(23)22(2)11-12-4-7-14(8-5-12)24-16(18)19/h4-10,16H,3,11H2,1-2H3,(H,21,23) |
| InChIKey | ZKMAVTCRBIBDQN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |