C15H14F2N2O2S — CID 134007817
N-[4-(difluoromethoxy)phenyl]-2-[(5-methyl-2-pyridinyl)sulfanyl]acetamide (PubChem CID 134007817) has the molecular formula C15H14F2N2O2S and a molecular weight of 324.35 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[(5-methyl-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[(5-methyl-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 134007817 |
| Molecular Formula | C15H14F2N2O2S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[(5-methyl-2-pyridinyl)sulfanyl]acetamide |
| SMILES | Cc1ccc(SCC(=O)Nc2ccc(OC(F)F)cc2)nc1 |
| InChI | InChI=1S/C15H14F2N2O2S/c1-10-2-7-14(18-8-10)22-9-13(20)19-11-3-5-12(6-4-11)21-15(16)17/h2-8,15H,9H2,1H3,(H,19,20) |
| InChIKey | YNKKGQFDYOBVNE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |