C14H10Cl2F2N2O2S — CID 112815647
N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[(5-chloro-2-pyridinyl)sulfanyl]acetamide (PubChem CID 112815647) has the molecular formula C14H10Cl2F2N2O2S and a molecular weight of 379.22 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[(5-chloro-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[(5-chloro-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 112815647 |
| Molecular Formula | C14H10Cl2F2N2O2S |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[(5-chloro-2-pyridinyl)sulfanyl]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cn1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2F2N2O2S/c15-8-1-4-13(19-6-8)23-7-12(21)20-9-2-3-11(10(16)5-9)22-14(17)18/h1-6,14H,7H2,(H,20,21) |
| InChIKey | JTRXLUKABLPPAN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |