C22H18ClF2N3O4 — CID 71937273
N-[6-(4-chlorophenoxy)-3-pyridinyl]-N'-[[4-(difluoromethoxy)phenyl]methyl]-N'-methyloxamide (PubChem CID 71937273) has the molecular formula C22H18ClF2N3O4 and a molecular weight of 461.85 g/mol. Its IUPAC name is N-[6-(4-chlorophenoxy)-3-pyridinyl]-N'-[[4-(difluoromethoxy)phenyl]methyl]-N'-methyloxamide.
| Compound Name | N-[6-(4-chlorophenoxy)-3-pyridinyl]-N'-[[4-(difluoromethoxy)phenyl]methyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 71937273 |
| Molecular Formula | C22H18ClF2N3O4 |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[6-(4-chlorophenoxy)-3-pyridinyl]-N'-[[4-(difluoromethoxy)phenyl]methyl]-N'-methyloxamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)C(=O)Nc1ccc(Oc2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C22H18ClF2N3O4/c1-28(13-14-2-7-18(8-3-14)32-22(24)25)21(30)20(29)27-16-6-11-19(26-12-16)31-17-9-4-15(23)5-10-17/h2-12,22H,13H2,1H3,(H,27,29) |
| InChIKey | FMAHZOVOISJVHE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|