C18H13F3N2O5 — CID 7843207
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(4-cyanophenoxy)acetate (PubChem CID 7843207) has the molecular formula C18H13F3N2O5 and a molecular weight of 394.31 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 7843207 |
| Molecular Formula | C18H13F3N2O5 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(4-cyanophenoxy)acetate |
| SMILES | N#Cc1ccc(OCC(=O)OCC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H13F3N2O5/c19-18(20,21)28-15-7-3-13(4-8-15)23-16(24)10-27-17(25)11-26-14-5-1-12(9-22)2-6-14/h1-8H,10-11H2,(H,23,24) |
| InChIKey | LVGUGJFMMBTADY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |