C15H12F3NO5 — CID 3900377
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-methylfuran-3-carboxylate (PubChem CID 3900377) has the molecular formula C15H12F3NO5 and a molecular weight of 343.26 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-methylfuran-3-carboxylate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 3900377 |
| Molecular Formula | C15H12F3NO5 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-methylfuran-3-carboxylate |
| SMILES | Cc1occc1C(=O)OCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F3NO5/c1-9-12(6-7-22-9)14(21)23-8-13(20)19-10-2-4-11(5-3-10)24-15(16,17)18/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | GFJAETMPDMWTET-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |