C15H15NO4 — CID 8965756
[2-(2-methylanilino)-2-oxoethyl] 2-methylfuran-3-carboxylate (PubChem CID 8965756) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 2-methylfuran-3-carboxylate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8965756 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 2-methylfuran-3-carboxylate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)c1ccoc1C |
| InChI | InChI=1S/C15H15NO4/c1-10-5-3-4-6-13(10)16-14(17)9-20-15(18)12-7-8-19-11(12)2/h3-8H,9H2,1-2H3,(H,16,17) |
| InChIKey | RUVGKBXKJAGNIL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |